Structure of PDB 3h6u Chain A Binding Site BS02 |
|
|
Ligand ID | NS3 |
InChI | InChI=1S/C18H28N4O4S2/c1-13-11-15-17(27(23,24)20-18(19-15)14-5-3-4-6-14)12-16(13)28(25,26)22-9-7-21(2)8-10-22/h11-12,14,18-20H,3-10H2,1-2H3/t18-/m0/s1 |
InChIKey | CUMKMTBOHBENJI-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CN1CCN(CC1)[S](=O)(=O)c2cc3c(N[C@@H](N[S]3(=O)=O)C4CCCC4)cc2C | ACDLabs 10.04 | O=S(=O)(c1c(cc2c(c1)S(=O)(=O)NC(N2)C3CCCC3)C)N4CCN(C)CC4 | OpenEye OEToolkits 1.5.0 | Cc1cc2c(cc1S(=O)(=O)N3CCN(CC3)C)S(=O)(=O)N[C@H](N2)C4CCCC4 | CACTVS 3.341 | CN1CCN(CC1)[S](=O)(=O)c2cc3c(N[CH](N[S]3(=O)=O)C4CCCC4)cc2C | OpenEye OEToolkits 1.5.0 | Cc1cc2c(cc1S(=O)(=O)N3CCN(CC3)C)S(=O)(=O)NC(N2)C4CCCC4 |
|
Formula | C18 H28 N4 O4 S2 |
Name | (3S)-3-cyclopentyl-6-methyl-7-[(4-methylpiperazin-1-yl)sulfonyl]-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide |
ChEMBL | |
DrugBank | DB08303 |
ZINC | ZINC000053683061
|
PDB chain | 3h6u Chain A Residue 265
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|