Structure of PDB 3gtc Chain A Binding Site BS02 |
|
|
Ligand ID | GTC |
InChI | InChI=1S/C9H13N3O2S/c13-8(14)6-4-2-1-3-5(6)7-10-9(15)12-11-7/h5-6H,1-4H2,(H,13,14)(H2,10,11,12,15)/t5-,6+/m0/s1 |
InChIKey | DYLXWYPNDHPRPQ-NTSWFWBYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | S=C1NC(=NN1)C2CCCCC2C(=O)O | CACTVS 3.341 | OC(=O)[CH]1CCCC[CH]1C2=NNC(=S)N2 | OpenEye OEToolkits 1.5.0 | C1CCC(C(C1)C2=NNC(=S)N2)C(=O)O | CACTVS 3.341 | OC(=O)[C@@H]1CCCC[C@@H]1C2=NNC(=S)N2 | OpenEye OEToolkits 1.5.0 | C1CC[C@H]([C@H](C1)C2=NNC(=S)N2)C(=O)O |
|
Formula | C9 H13 N3 O2 S |
Name | (1R,2S)-2-(5-thioxo-4,5-dihydro-1H-1,2,4-triazol-3-yl)cyclohexanecarboxylic acid |
ChEMBL | |
DrugBank | DB07850 |
ZINC | ZINC000005816947
|
PDB chain | 3gtc Chain A Residue 364
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|