Structure of PDB 3fug Chain A Binding Site BS02 |
|
|
Ligand ID | 2E3 |
InChI | InChI=1S/C24H28O3/c1-15-12-19-20(24(4,5)11-10-23(19,2)3)14-17(15)18-13-16(6-8-21(18)25)7-9-22(26)27/h6-9,12-14,25H,10-11H2,1-5H3,(H,26,27)/b9-7+ |
InChIKey | DYLLZSVPAUUSSB-VQHVLOKHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | Cc1cc2c(cc1c3cc(C=CC(O)=O)ccc3O)C(C)(C)CCC2(C)C | OpenEye OEToolkits 1.5.0 | Cc1cc2c(cc1c3cc(ccc3O)\C=C\C(=O)O)C(CCC2(C)C)(C)C | OpenEye OEToolkits 1.5.0 | Cc1cc2c(cc1c3cc(ccc3O)C=CC(=O)O)C(CCC2(C)C)(C)C | CACTVS 3.341 | Cc1cc2c(cc1c3cc(/C=C/C(O)=O)ccc3O)C(C)(C)CCC2(C)C | ACDLabs 10.04 | O=C(O)\C=C\c3cc(c1c(cc2c(c1)C(CCC2(C)C)(C)C)C)c(O)cc3 |
|
Formula | C24 H28 O3 |
Name | (2E)-3-[4-hydroxy-3-(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)phenyl]prop-2-enoic acid |
ChEMBL | CHEMBL491294 |
DrugBank | |
ZINC | ZINC000039257798
|
PDB chain | 3fug Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|