Structure of PDB 3ewc Chain A Binding Site BS02 |
|
|
Ligand ID | MCF |
InChI | InChI=1S/C12H18N4O4S/c1-21-3-7-9(18)10(19)12(20-7)16-5-15-8-6(17)2-13-4-14-11(8)16/h4-7,9-10,12,17-19H,2-3H2,1H3,(H,13,14)/t6-,7-,9-,10-,12-/m1/s1 |
InChIKey | QLPPCUVJNCMYFD-SANHVUMCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CSCC1C(C(C(O1)n2cnc3c2N=CNCC3O)O)O | OpenEye OEToolkits 1.5.0 | CSC[C@@H]1[C@H]([C@H]([C@@H](O1)n2cnc3c2N=CNC[C@H]3O)O)O | CACTVS 3.341 | CSC[CH]1O[CH]([CH](O)[CH]1O)n2cnc3[CH](O)CNC=Nc23 | CACTVS 3.341 | CSC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3[C@H](O)CNC=Nc23 | ACDLabs 10.04 | n2c1c(N=CNCC1O)n(c2)C3OC(C(O)C3O)CSC |
|
Formula | C12 H18 N4 O4 S |
Name | (8R)-3-(5-S-methyl-5-thio-beta-D-ribofuranosyl)-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol |
ChEMBL | CHEMBL1234234 |
DrugBank | |
ZINC | ZINC000043171427
|
PDB chain | 3ewc Chain A Residue 373
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|