Structure of PDB 3eos Chain A Binding Site BS02 |
|
|
Ligand ID | PK2 |
InChI | InChI=1S/C19H27N7O/c1-21-19-23-14-9-13-15(24-18(20)26-17(13)27)12(16(14)25-19)7-8-22-10-11-5-3-2-4-6-11/h9,11,22H,2-8,10H2,1H3,(H2,21,23,25)(H3,20,24,26,27) |
InChIKey | ZKRVOXSNLYAMLM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C1c3c(N=C(N)N1)c(c2nc(nc2c3)NC)CCNCC4CCCCC4 | OpenEye OEToolkits 1.5.0 | CNc1[nH]c2cc3c(c(c2n1)CCNCC4CCCCC4)N=C(NC3=O)N | CACTVS 3.341 | CNc1[nH]c2cc3C(=O)NC(=Nc3c(CCNCC4CCCCC4)c2n1)N |
|
Formula | C19 H27 N7 O |
Name | 6-amino-4-{2-[(cyclohexylmethyl)amino]ethyl}-2-(methylamino)-1,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000039195957
|
PDB chain | 3eos Chain A Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|