Structure of PDB 3elc Chain A Binding Site BS02 |
|
|
Ligand ID | F01 |
InChI | InChI=1S/C9H12FN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)/t4-,5-,6-,8-/m1/s1 |
InChIKey | STRZQWQNZQMHQR-UAKXSSHOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | NC1=NC(=O)N(C=C1F)[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O | ACDLabs 10.04 | FC=1C(=NC(=O)N(C=1)C2OC(C(O)C2O)CO)N | OpenEye OEToolkits 1.5.0 | C1=C(C(=NC(=O)N1C2C(C(C(O2)CO)O)O)N)F | CACTVS 3.341 | NC1=NC(=O)N(C=C1F)[CH]2O[CH](CO)[CH](O)[CH]2O | OpenEye OEToolkits 1.5.0 | C1=C(C(=NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N)F |
|
Formula | C9 H12 F N3 O5 |
Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-pyrimidin-2-one; 4-amino-5-fluoro-1-((2R,3S,4R,5R)-tetrahydro-3,4-dihydroxy-5-(hydroxymethyl)furan-2-yl)pyrimidin-2(1H)-one |
ChEMBL | CHEMBL490033 |
DrugBank | |
ZINC | ZINC000004255900
|
PDB chain | 3elc Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.6.1.12: 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase. |
|
|
|