Structure of PDB 3e87 Chain A Binding Site BS02 |
|
|
Ligand ID | G95 |
InChI | InChI=1S/C20H18N4OS/c21-12-16(13-4-2-1-3-5-13)24-20(25)18-7-6-17(26-18)14-8-10-22-19-15(14)9-11-23-19/h1-11,16H,12,21H2,(H,22,23)(H,24,25)/t16-/m1/s1 |
InChIKey | TWYNGDRSMHRPSY-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1ccc(cc1)C(CN)NC(=O)c2ccc(s2)c3ccnc4c3cc[nH]4 | CACTVS 3.341 | NC[CH](NC(=O)c1sc(cc1)c2ccnc3[nH]ccc23)c4ccccc4 | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)[C@@H](CN)NC(=O)c2ccc(s2)c3ccnc4c3cc[nH]4 | CACTVS 3.341 | NC[C@@H](NC(=O)c1sc(cc1)c2ccnc3[nH]ccc23)c4ccccc4 | ACDLabs 10.04 | O=C(c3sc(c1c2c(ncc1)ncc2)cc3)NC(c4ccccc4)CN |
|
Formula | C20 H18 N4 O S |
Name | N-[(1S)-2-amino-1-phenylethyl]-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)thiophene-2-carboxamide |
ChEMBL | |
DrugBank | DB07812 |
ZINC | ZINC000039187982
|
PDB chain | 3e87 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|