Structure of PDB 3dd8 Chain A Binding Site BS02 |
|
|
Ligand ID | 2C7 |
InChI | InChI=1S/C16H21NO5S2/c17-24(20,21)22-14-8-7-13-10-15(23(18,19)16(13)11-14)9-12-5-3-1-2-4-6-12/h7-8,10-12H,1-6,9H2,(H2,17,20,21) |
InChIKey | BIASYWBGUYOWJR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc2c(cc1OS(=O)(=O)N)S(=O)(=O)C(=C2)CC3CCCCCC3 | CACTVS 3.341 | N[S](=O)(=O)Oc1ccc2C=C(CC3CCCCCC3)[S](=O)(=O)c2c1 | ACDLabs 10.04 | O=S(=O)(Oc1ccc2c(c1)S(=O)(=O)C(=C2)CC3CCCCCC3)N |
|
Formula | C16 H21 N O5 S2 |
Name | 2-(cycloheptylmethyl)-1,1-dioxido-1-benzothiophen-6-yl sulfamate |
ChEMBL | CHEMBL476937 |
DrugBank | DB06954 |
ZINC | ZINC000039123364
|
PDB chain | 3dd8 Chain A Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|