Structure of PDB 3d7w Chain A Binding Site BS02 |
|
|
Ligand ID | ZEZ |
InChI | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15)/b7-2- |
InChIKey | UZKQTCBAMSWPJD-UQCOIBPSSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC(=CCNc1c2c([nH]cn2)ncn1)CO | ACDLabs 10.04 | n2c1c(ncn1)c(nc2)NC/C=C(/C)CO | CACTVS 3.341 | CC(CO)=CCNc1ncnc2[nH]cnc12 | CACTVS 3.341 | C\C(CO)=C\CNc1ncnc2[nH]cnc12 | OpenEye OEToolkits 1.5.0 | C/C(=C/CNc1c2c([nH]cn2)ncn1)/CO |
|
Formula | C10 H13 N5 O |
Name | (2Z)-2-methyl-4-(9H-purin-6-ylamino)but-2-en-1-ol; CIS-ZEATIN |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013523718
|
PDB chain | 3d7w Chain B Residue 702
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
V77 E165 R168 |
Catalytic site (residue number reindexed from 1) |
V77 E165 R168 |
Enzyme Commision number |
3.2.2.22: rRNA N-glycosylase. |
|
|
|