Structure of PDB 3d3p Chain A Binding Site BS02 |
|
|
Ligand ID | 20A |
InChI | InChI=1S/C21H25N5O2/c1-2-26-20-17(14-24-26)19(25-16-8-10-28-11-9-16)18(13-22-20)21(27)23-12-15-6-4-3-5-7-15/h3-7,13-14,16H,2,8-12H2,1H3,(H,22,25)(H,23,27) |
InChIKey | QZGJNFBMYYEFGM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C(NCc1ccccc1)c2c(c3c(nc2)n(nc3)CC)NC4CCOCC4 | OpenEye OEToolkits 1.5.0 | CCn1c2c(cn1)c(c(cn2)C(=O)NCc3ccccc3)NC4CCOCC4 | CACTVS 3.341 | CCn1ncc2c(NC3CCOCC3)c(cnc12)C(=O)NCc4ccccc4 |
|
Formula | C21 H25 N5 O2 |
Name | 1-ethyl-N-(phenylmethyl)-4-(tetrahydro-2H-pyran-4-ylamino)-1H-pyrazolo[3,4-b]pyridine-5-carboxamide; N-benzyl-1-ethyl-4-(tetrahydro-2H-pyran-4-ylamino)-1H-pyrazolo[3,4-b]pyridine-5-carboxamide |
ChEMBL | CHEMBL521203 |
DrugBank | DB06909 |
ZINC | ZINC000042878481
|
PDB chain | 3d3p Chain A Residue 505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.53: 3',5'-cyclic-AMP phosphodiesterase. |
|
|
|