Structure of PDB 3c56 Chain A Binding Site BS02 |
|
|
Ligand ID | PH4 |
InChI | InChI=1S/C5H13NO10P2/c7-5(4-16-18(12,13)14)6(8)2-1-3-15-17(9,10)11/h8H,1-4H2,(H2,9,10,11)(H2,12,13,14) |
InChIKey | IISKWLQYGVRJHI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C(CN(C(=O)COP(=O)(O)O)O)COP(=O)(O)O | CACTVS 3.341 | ON(CCCO[P](O)(O)=O)C(=O)CO[P](O)(O)=O | ACDLabs 10.04 | O=P(O)(OCCCN(O)C(=O)COP(=O)(O)O)O |
|
Formula | C5 H13 N O10 P2 |
Name | 3-{hydroxy[(phosphonooxy)acetyl]amino}propyl dihydrogen phosphate |
ChEMBL | CHEMBL1235276 |
DrugBank | |
ZINC | ZINC000058638417
|
PDB chain | 3c56 Chain A Residue 309
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|