Structure of PDB 3c3d Chain A Binding Site BS02 |
|
|
Ligand ID | FO1 |
InChI | InChI=1S/C16H17N3O7/c20-6-12(23)13(24)11(22)5-19-10-4-8(21)2-1-7(10)3-9-14(19)17-16(26)18-15(9)25/h1-4,11-13,20-24H,5-6H2,(H,18,25,26)/t11-,12+,13-/m0/s1 |
InChIKey | AUEILLWDYUBWCM-XQQFMLRXSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc2c(cc1O)N(C3=NC(=O)NC(=O)C3=C2)C[C@@H]([C@@H]([C@@H](CO)O)O)O | ACDLabs 10.04 | O=C1C=3C(=NC(=O)N1)N(c2c(ccc(O)c2)C=3)CC(O)C(O)C(O)CO | CACTVS 3.341 | OC[CH](O)[CH](O)[CH](O)CN1c2cc(O)ccc2C=C3C(=O)NC(=O)N=C13 | CACTVS 3.341 | OC[C@@H](O)[C@@H](O)[C@@H](O)CN1c2cc(O)ccc2C=C3C(=O)NC(=O)N=C13 | OpenEye OEToolkits 1.5.0 | c1cc2c(cc1O)N(C3=NC(=O)NC(=O)C3=C2)CC(C(C(CO)O)O)O |
|
Formula | C16 H17 N3 O7 |
Name | 1-deoxy-1-(8-hydroxy-2,4-dioxo-3,4-dihydropyrimido[4,5-b]quinolin-10(2H)-yl)-D-ribitol; 7,8-didemethyl-8-hydroxy-5-deazariboflavin |
ChEMBL | |
DrugBank | |
ZINC | ZINC000100069844
|
PDB chain | 3c3d Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.8.28: 2-phospho-L-lactate transferase. |
|
|
|