Structure of PDB 3c2y Chain A Binding Site BS02 |
|
|
Ligand ID | S60 |
InChI | InChI=1S/C10H9N5O/c1-4-12-7-2-5-6(3-8(7)13-4)14-10(11)15-9(5)16/h2-3H,1H3,(H,12,13)(H3,11,14,15,16) |
InChIKey | PLJNUNPYZVVIRA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | Cc1[nH]c2cc3c(cc2n1)N=C(NC3=O)N | ACDLabs 10.04 | O=C1c3c(N=C(N)N1)cc2nc(nc2c3)C | CACTVS 3.341 | Cc1[nH]c2cc3C(=O)NC(=Nc3cc2n1)N |
|
Formula | C10 H9 N5 O |
Name | 6-amino-2-methyl-1,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one; 2-methyl-lin-Benzoguanine |
ChEMBL | CHEMBL1235810 |
DrugBank | DB08511 |
ZINC |
|
PDB chain | 3c2y Chain A Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|