Structure of PDB 3bll Chain A Binding Site BS02 |
|
|
Ligand ID | BPQ |
InChI | InChI=1S/C12H17N5O3/c1-12(2,3)20-11(19)15-5-6-4-14-8-7(6)9(18)17-10(13)16-8/h4H,5H2,1-3H3,(H,15,19)(H4,13,14,16,17,18) |
InChIKey | RXVQMCMIOHBKNE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC(C)(C)OC(=O)NCc1c[nH]c2c1C(=O)NC(=N2)N | ACDLabs 10.04 | O=C(OC(C)(C)C)NCc1cnc2N=C(NC(=O)c12)N | CACTVS 3.341 | CC(C)(C)OC(=O)NCc1c[nH]c2N=C(N)NC(=O)c12 |
|
Formula | C12 H17 N5 O3 |
Name | tert-butyl [(2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl]carbamate |
ChEMBL | |
DrugBank | DB07481 |
ZINC | ZINC000039046718
|
PDB chain | 3bll Chain A Residue 700
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|