Structure of PDB 3bl0 Chain A Binding Site BS02 |
|
|
Ligand ID | BL0 |
InChI | InChI=1S/C5H10N4O2S2/c1-9(2)5-8-7-4(12-5)3-13(6,10)11/h3H2,1-2H3,(H2,6,10,11) |
InChIKey | HZGQWVQLUYIYQA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CN(C)c1sc(C[S](N)(=O)=O)nn1 | OpenEye OEToolkits 1.5.0 | CN(C)c1nnc(s1)CS(=O)(=O)N | ACDLabs 10.04 | O=S(=O)(N)Cc1nnc(s1)N(C)C |
|
Formula | C5 H10 N4 O2 S2 |
Name | 1-[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]methanesulfonamide; 2-N,N-Dimethylamino-1,3,4-thiadiazole-5-methanesulfonamide |
ChEMBL | CHEMBL403287 |
DrugBank | |
ZINC | ZINC000029127817
|
PDB chain | 3bl0 Chain A Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|