Structure of PDB 3aen Chain A Binding Site BS02 |
|
|
Ligand ID | 4LM |
InChI | InChI=1S/C12H15N2O7P/c1-3-10(12(16)17)14-5-9-8(6-21-22(18,19)20)4-13-7(2)11(9)15/h3-5,15H,6H2,1-2H3,(H,16,17)(H2,18,19,20)/b10-3+,14-5+ |
InChIKey | BBYSOXSBJOWRNU-VMTXVVAMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC=C(N=Cc1c(O)c(C)ncc1CO[P](O)(O)=O)C(O)=O | OpenEye OEToolkits 1.7.0 | CC=C(C(=O)O)N=Cc1c(cnc(c1O)C)COP(=O)(O)O | OpenEye OEToolkits 1.7.0 | C/C=C(\C(=O)O)/N=C/c1c(cnc(c1O)C)COP(=O)(O)O | CACTVS 3.370 | C\C=C(N=Cc1c(O)c(C)ncc1CO[P](O)(O)=O)/C(O)=O | ACDLabs 12.01 | O=P(O)(O)OCc1cnc(c(O)c1/C=N/C(=C/C)C(=O)O)C |
|
Formula | C12 H15 N2 O7 P |
Name | (2E)-2-{[(1E)-{3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methylidene]amino}but-2-enoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000064746507
|
PDB chain | 3aen Chain D Residue 2003
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.4.1.11: methionine gamma-lyase. |
|
|
|