Structure of PDB 2zft Chain A Binding Site BS02 |
|
|
Ligand ID | 10U |
InChI | InChI=1S/C20H29N5O2/c21-19(22)15-9-7-14(8-10-15)12-24-20(27)17-6-3-11-25(17)18(26)13-23-16-4-1-2-5-16/h7-10,16-17,23H,1-6,11-13H2,(H3,21,22)(H,24,27)/t17-/m0/s1 |
InChIKey | WXYKSWZWRHMJTE-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(NCc1ccc(C(=[N@H])N)cc1)C3N(C(=O)CNC2CCCC2)CCC3 | OpenEye OEToolkits 1.7.5 | c1cc(ccc1CNC(=O)C2CCCN2C(=O)CNC3CCCC3)C(=N)N | OpenEye OEToolkits 1.7.5 | c1cc(ccc1CNC(=O)[C@@H]2CCCN2C(=O)CNC3CCCC3)C(=N)N | CACTVS 3.385 | NC(=N)c1ccc(CNC(=O)[CH]2CCCN2C(=O)CNC3CCCC3)cc1 | CACTVS 3.385 | NC(=N)c1ccc(CNC(=O)[C@@H]2CCCN2C(=O)CNC3CCCC3)cc1 |
|
Formula | C20 H29 N5 O2 |
Name | (S)-N-(4-carbamimidoylbenzyl)-1-(2-(cyclopentylamino)ethanoyl)pyrrolidine-2-carboxamide; (2S)-1-[cyclopentylamino)acetyl-N-{4-[amino(imino)methyl]benzyl}pyrrolidine-2-carboxamide |
ChEMBL | |
DrugBank | DB06845 |
ZINC | ZINC000013165429
|
PDB chain | 2zft Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|