Structure of PDB 2zfs Chain A Binding Site BS02 |
|
|
Ligand ID | 12U |
InChI | InChI=1S/C22H33N5O2/c23-21(24)17-11-9-16(10-12-17)14-26-22(29)19-8-5-13-27(19)20(28)15-25-18-6-3-1-2-4-7-18/h9-12,18-19,25H,1-8,13-15H2,(H3,23,24)(H,26,29)/t19-/m0/s1 |
InChIKey | BYTJPDBCLWUEBU-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.5 | c1cc(ccc1CNC(=O)C2CCCN2C(=O)CNC3CCCCCC3)C(=N)N | ACDLabs 10.04 | O=C(NCc1ccc(C(=[N@H])N)cc1)C3N(C(=O)CNC2CCCCCC2)CCC3 | OpenEye OEToolkits 1.7.5 | [H]/N=C(/c1ccc(cc1)CNC(=O)[C@@H]2CCCN2C(=O)CNC3CCCCCC3)\N | CACTVS 3.385 | NC(=N)c1ccc(CNC(=O)[CH]2CCCN2C(=O)CNC3CCCCCC3)cc1 | CACTVS 3.385 | NC(=N)c1ccc(CNC(=O)[C@@H]2CCCN2C(=O)CNC3CCCCCC3)cc1 |
|
Formula | C22 H33 N5 O2 |
Name | N-cycloheptylglycyl-N-(4-carbamimidoylbenzyl)-L-prolinamide; (2S)-N-[(4-carbamimidoylphenyl)methyl]-1-[2-(cycloheptylamino)ethanoyl]pyrrolidine-2-carboxamide |
ChEMBL | |
DrugBank | DB06853 |
ZINC | ZINC000039024438
|
PDB chain | 2zfs Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|