Structure of PDB 2rdt Chain A Binding Site BS02 |
|
|
Ligand ID | 2RD |
InChI | InChI=1S/C15H27N3O2S/c1-2-3-4-5-6-7-8-9-10-11-12-21-14-13(15(19)20)16-18-17-14/h2-12H2,1H3,(H,19,20)(H,16,17,18) |
InChIKey | IEZPFPQAXAREGM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CCCCCCCCCCCCSc1[nH]nnc1C(O)=O | OpenEye OEToolkits 1.5.0 | CCCCCCCCCCCCSc1c(nn[nH]1)C(=O)O | ACDLabs 10.04 | O=C(O)c1nnnc1SCCCCCCCCCCCC |
|
Formula | C15 H27 N3 O2 S |
Name | 5-(dodecylthio)-1H-1,2,3-triazole-4-carboxylic acid; 4-carboxy-5-dodecylsulfanyl-1,2,3-triazole |
ChEMBL | CHEMBL1229989 |
DrugBank | DB06979 |
ZINC | ZINC000016052525
|
PDB chain | 2rdt Chain A Residue 365
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|