Structure of PDB 2qzr Chain A Binding Site BS02 |
|
|
Ligand ID | S79 |
InChI | InChI=1S/C20H16N6O/c21-19-23-15-9-17-16(8-14(15)18(27)26-19)24-20(25-17)22-10-12-6-3-5-11-4-1-2-7-13(11)12/h1-9H,10H2,(H2,22,24,25)(H3,21,23,26,27) |
InChIKey | MCEZMMDIEXECTI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1ccc2c(c1)cccc2CNc3[nH]c4cc5c(cc4n3)C(=O)NC(=N5)N | CACTVS 3.341 | NC1=Nc2cc3[nH]c(NCc4cccc5ccccc45)nc3cc2C(=O)N1 | ACDLabs 10.04 | O=C1NC(=Nc3c1cc2nc(nc2c3)NCc5c4ccccc4ccc5)N |
|
Formula | C20 H16 N6 O |
Name | 6-amino-2-[(1-naphthylmethyl)amino]-3,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one |
ChEMBL | |
DrugBank | DB08512 |
ZINC | ZINC000016052484
|
PDB chain | 2qzr Chain A Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|