Structure of PDB 2qr9 Chain A Binding Site BS02 |
|
|
Ligand ID | HZ3 |
InChI | InChI=1S/C22H18O7/c1-27-21(25)17-18(22(26)28-2)20-16(12-5-9-14(24)10-6-12)15(19(17)29-20)11-3-7-13(23)8-4-11/h3-10,19-20,23-24H,1-2H3/t19-,20+ |
InChIKey | CRLQCBACIMUGDZ-BGYRXZFFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | COC(=O)C1=C([CH]2O[CH]1C(=C2c3ccc(O)cc3)c4ccc(O)cc4)C(=O)OC | CACTVS 3.341 | COC(=O)C1=C([C@H]2O[C@@H]1C(=C2c3ccc(O)cc3)c4ccc(O)cc4)C(=O)OC | OpenEye OEToolkits 1.5.0 | COC(=O)C1=C([C@@H]2C(=C([C@H]1O2)c3ccc(cc3)O)c4ccc(cc4)O)C(=O)OC | OpenEye OEToolkits 1.5.0 | COC(=O)C1=C(C2C(=C(C1O2)c3ccc(cc3)O)c4ccc(cc4)O)C(=O)OC | ACDLabs 10.04 | O=C(OC)C4=C(C(=O)OC)C2OC4C(=C2c1ccc(O)cc1)c3ccc(O)cc3 |
|
Formula | C22 H18 O7 |
Name | dimethyl (1R,4S)-5,6-bis(4-hydroxyphenyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
ChEMBL | CHEMBL1213270 |
DrugBank | DB07932 |
ZINC | ZINC000016052474
|
PDB chain | 2qr9 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|