Structure of PDB 2qo8 Chain A Binding Site BS02 |
|
|
Ligand ID | 3CC |
InChI | InChI=1S/C17H26N2O3S/c1-3-5-12(6-4-2)17(20)19-15-9-13-7-8-16(23(18,21)22)11-14(13)10-15/h7-8,11-12,15H,3-6,9-10H2,1-2H3,(H,19,20)(H2,18,21,22)/t15-/m1/s1 |
InChIKey | XBYJCVDSFWJBSM-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCCC(CCC)C(=O)N[C@@H]1Cc2ccc(cc2C1)S(=O)(=O)N | CACTVS 3.341 | CCCC(CCC)C(=O)N[CH]1Cc2ccc(cc2C1)[S](N)(=O)=O | OpenEye OEToolkits 1.5.0 | CCCC(CCC)C(=O)NC1Cc2ccc(cc2C1)S(=O)(=O)N | CACTVS 3.341 | CCCC(CCC)C(=O)N[C@@H]1Cc2ccc(cc2C1)[S](N)(=O)=O | ACDLabs 10.04 | O=S(=O)(c1ccc2c(c1)CC(NC(=O)C(CCC)CCC)C2)N |
|
Formula | C17 H26 N2 O3 S |
Name | N-[(2R)-5-(aminosulfonyl)-2,3-dihydro-1H-inden-2-yl]-2-propylpentanamide |
ChEMBL | |
DrugBank | DB07048 |
ZINC | ZINC000013686386
|
PDB chain | 2qo8 Chain A Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|