Structure of PDB 2fky Chain A Binding Site BS02 |
|
|
Ligand ID | N2T |
InChI | InChI=1S/C23H25F2N3O/c1-27(19-9-11-26-12-10-19)23(29)28-15-17(20-14-18(24)7-8-21(20)25)13-22(28)16-5-3-2-4-6-16/h2-8,13-14,19,22,26H,9-12,15H2,1H3/t22-/m0/s1 |
InChIKey | NKLVBHMAIMEVEH-QFIPXVFZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CN(C1CCNCC1)C(=O)N2CC(=C[C@H]2c3ccccc3)c4cc(ccc4F)F | CACTVS 3.341 | CN(C1CCNCC1)C(=O)N2CC(=C[C@H]2c3ccccc3)c4cc(F)ccc4F | ACDLabs 10.04 | Fc1cc(c(F)cc1)C4=CC(c2ccccc2)N(C(=O)N(C)C3CCNCC3)C4 | CACTVS 3.341 | CN(C1CCNCC1)C(=O)N2CC(=C[CH]2c3ccccc3)c4cc(F)ccc4F | OpenEye OEToolkits 1.5.0 | CN(C1CCNCC1)C(=O)N2CC(=CC2c3ccccc3)c4cc(ccc4F)F |
|
Formula | C23 H25 F2 N3 O |
Name | (2S)-4-(2,5-DIFLUOROPHENYL)-N-METHYL-2-PHENYL-N-PIPERIDIN-4-YL-2,5-DIHYDRO-1H-PYRROLE-1-CARBOXAMIDE |
ChEMBL | CHEMBL205437 |
DrugBank | DB08239 |
ZINC | ZINC000013982377
|
PDB chain | 2fky Chain A Residue 604
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|