Structure of PDB 2anq Chain A Binding Site BS02 |
|
|
Ligand ID | C1A |
InChI | InChI=1S/C14H22N8S2/c1-7-3-10(6-24-14(20)22-12(17)18)8(2)4-9(7)5-23-13(19)21-11(15)16/h3-4H,5-6H2,1-2H3,(H5,15,16,19,21)(H5,17,18,20,22) |
InChIKey | UQMGTQSCMRRWFV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cc1cc(CSC(=N)NC(N)=N)c(C)cc1CSC(=N)NC(N)=N | OpenEye OEToolkits 1.7.2 | [H]/N=C(/N/C(=N\[H])/SCc1c(cc(c(c1)C)CS/C(=N/[H])/N/C(=N/[H])/N)C)\N | OpenEye OEToolkits 1.7.2 | Cc1cc(c(cc1CSC(=N)NC(=N)N)C)CSC(=N)NC(=N)N | ACDLabs 12.01 | S(C(=[N@H])NC(=[N@H])N)Cc1cc(c(cc1C)CSC(=[N@H])NC(=[N@H])N)C |
|
Formula | C14 H22 N8 S2 |
Name | (2,5-dimethylbenzene-1,4-diyl)dimethanediyl bis(N-carbamimidoylcarbamimidothioate); 4-({[(E)-{[(E)-AMINO(IMINO)METHYL]AMINO}(IMINO)METHYL]SULFANYL}METHYL)-2,5-DIMETHYLBENZYL N-[(E)-AMINO(IMINO)METHYL]IMIDOTHIOCARBAMATE |
ChEMBL | CHEMBL213969 |
DrugBank | |
ZINC | ZINC000014966613
|
PDB chain | 2anq Chain A Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|