Structure of PDB 1mlw Chain A Binding Site BS02 |
|
|
Ligand ID | HBI |
InChI | InChI=1S/C9H13N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3,6,15-16H,2H2,1H3,(H4,10,11,13,14,17)/t3-,6-/m0/s1 |
InChIKey | FEMXZDUTFRTWPE-DZSWIPIPSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC(C(C1=NC2=C(NC1)N=C(NC2=O)N)O)O | OpenEye OEToolkits 1.5.0 | C[C@@H]([C@@H](C1=NC2=C(NC1)N=C(NC2=O)N)O)O | CACTVS 3.341 | C[C@H](O)[C@H](O)C1=NC2=C(NC1)N=C(N)NC2=O | ACDLabs 10.04 | O=C1NC(=NC=2NCC(=NC1=2)C(O)C(O)C)N | CACTVS 3.341 | C[CH](O)[CH](O)C1=NC2=C(NC1)N=C(N)NC2=O |
|
Formula | C9 H13 N5 O3 |
Name | 7,8-DIHYDROBIOPTERIN |
ChEMBL | |
DrugBank | DB04400 |
ZINC | ZINC000018181336
|
PDB chain | 1mlw Chain A Residue 900
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
Molecular Function |
GO:0004497 |
monooxygenase activity |
GO:0005506 |
iron ion binding |
GO:0016714 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen |
|
|