Structure of PDB 1m6p Chain A Binding Site BS02 |
|
|
Ligand ID | M6P |
InChI | InChI=1S/C6H13O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5+,6+/m1/s1 |
InChIKey | NBSCHQHZLSJFNQ-PQMKYFCFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | O[CH]1O[CH](CO[P](O)(O)=O)[CH](O)[CH](O)[CH]1O | CACTVS 3.341 | O[C@H]1O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@H](O)[C@@H]1O | OpenEye OEToolkits 1.5.0 | C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)O)O)O)O)OP(=O)(O)O | OpenEye OEToolkits 1.5.0 | C(C1C(C(C(C(O1)O)O)O)O)OP(=O)(O)O | ACDLabs 10.04 | O=P(O)(O)OCC1OC(O)C(O)C(O)C1O |
|
Formula | C6 H13 O9 P |
Name | 6-O-phosphono-alpha-D-mannopyranose; ALPHA-D-MANNOSE-6-PHOSPHATE; 6-O-phosphono-alpha-D-mannose; 6-O-phosphono-D-mannose; 6-O-phosphono-mannose |
ChEMBL | CHEMBL402001 |
DrugBank | DB02900 |
ZINC | ZINC000004096188
|
PDB chain | 1m6p Chain A Residue 200
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|