Structure of PDB 1l2i Chain A Binding Site BS02 |
|
|
Ligand ID | ETC |
InChI | InChI=1S/C22H24O2/c1-3-13-9-15-11-17(23)6-8-20(15)22-14(4-2)10-16-12-18(24)5-7-19(16)21(13)22/h5-8,11-14,23-24H,3-4,9-10H2,1-2H3/t13-,14-/m1/s1 |
InChIKey | MASYAWHPJCQLSW-ZIAGYGMSSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCC1Cc2cc(ccc2C3=C1c4ccc(cc4CC3CC)O)O | CACTVS 3.341 | CC[C@@H]1Cc2cc(O)ccc2C3=C1c4ccc(O)cc4C[C@H]3CC | CACTVS 3.341 | CC[CH]1Cc2cc(O)ccc2C3=C1c4ccc(O)cc4C[CH]3CC | OpenEye OEToolkits 1.5.0 | CC[C@@H]1Cc2cc(ccc2C3=C1c4ccc(cc4C[C@H]3CC)O)O | ACDLabs 10.04 | Oc4cc3c(C2=C(c1ccc(O)cc1CC2CC)C(CC)C3)cc4 |
|
Formula | C22 H24 O2 |
Name | (R,R)-5,11-CIS-DIETHYL-5,6,11,12-TETRAHYDROCHRYSENE-2,8-DIOL |
ChEMBL | CHEMBL282489 |
DrugBank | |
ZINC | ZINC000003940885
|
PDB chain | 1l2i Chain A Residue 600
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|