Structure of PDB 1if8 Chain A Binding Site BS02 |
|
|
Ligand ID | SBS |
InChI | InChI=1S/C19H21N3O3S/c1-14(13-22-11-10-15-4-2-3-5-18(15)22)12-21-19(23)16-6-8-17(9-7-16)26(20,24)25/h2-11,14H,12-13H2,1H3,(H,21,23)(H2,20,24,25)/t14-/m0/s1 |
InChIKey | ZFWHOUCRVSOZJE-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C[C@@H](CNC(=O)c1ccc(cc1)S(=O)(=O)N)Cn2ccc3c2cccc3 | OpenEye OEToolkits 1.5.0 | CC(CNC(=O)c1ccc(cc1)S(=O)(=O)N)Cn2ccc3c2cccc3 | CACTVS 3.341 | C[CH](CNC(=O)c1ccc(cc1)[S](N)(=O)=O)Cn2ccc3ccccc23 | ACDLabs 10.04 | O=S(=O)(N)c1ccc(cc1)C(=O)NCC(C)Cn3c2ccccc2cc3 | CACTVS 3.341 | C[C@@H](CNC(=O)c1ccc(cc1)[S](N)(=O)=O)Cn2ccc3ccccc23 |
|
Formula | C19 H21 N3 O3 S |
Name | (S)-N-(3-INDOL-1-YL-2-METHYL-PROPYL)-4-SULFAMOYL-BENZAMIDE |
ChEMBL | |
DrugBank | DB03950 |
ZINC | ZINC000003581175
|
PDB chain | 1if8 Chain A Residue 555
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|