Structure of PDB 1btu Chain A Binding Site BS02 |
|
|
Ligand ID | 2BL |
InChI | InChI=1S/C13H17NO6S/c1-3-10(12(15)16)11(13(17)18)14-21(19,20)9-6-4-8(2)5-7-9/h4-7,10-11,14H,3H2,1-2H3,(H,15,16)(H,17,18)/t10-,11+/m1/s1 |
InChIKey | KPHLTCNXHCHMOW-MNOVXSKESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCC(C(C(=O)O)NS(=O)(=O)c1ccc(cc1)C)C(=O)O | OpenEye OEToolkits 1.5.0 | CC[C@H]([C@@H](C(=O)O)NS(=O)(=O)c1ccc(cc1)C)C(=O)O | CACTVS 3.341 | CC[CH]([CH](N[S](=O)(=O)c1ccc(C)cc1)C(O)=O)C(O)=O | ACDLabs 10.04 | O=S(=O)(c1ccc(cc1)C)NC(C(=O)O)C(C(=O)O)CC | CACTVS 3.341 | CC[C@H]([C@H](N[S](=O)(=O)c1ccc(C)cc1)C(O)=O)C(O)=O |
|
Formula | C13 H17 N O6 S |
Name | (3R)-3-ethyl-N-[(4-methylphenyl)sulfonyl]-L-aspartic acid |
ChEMBL | |
DrugBank | DB06951 |
ZINC | ZINC000002047341
|
PDB chain | 1btu Chain A Residue 7
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|