Structure of PDB 4lqi Chain Y Binding Site BS01 |
|
|
Ligand ID | 1Y9 |
InChI | InChI=1S/C12H18O3/c1-9(2)3-4-12(8-14)6-10(7-13)5-11(12)15/h3,6,8,11,13,15H,4-5,7H2,1-2H3/t11-,12-/m0/s1 |
InChIKey | WFKBKCXWCUVGHP-RYUDHWBXSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=CC1(C=C(CC1O)CO)C\C=C(/C)C | CACTVS 3.385 | CC(C)=CC[C]1(C=O)C=C(CO)C[CH]1O | OpenEye OEToolkits 1.7.6 | CC(=CC[C@]1(C=C(C[C@@H]1O)CO)C=O)C | OpenEye OEToolkits 1.7.6 | CC(=CCC1(C=C(CC1O)CO)C=O)C | CACTVS 3.385 | CC(C)=CC[C@@]1(C=O)C=C(CO)C[C@@H]1O |
|
Formula | C12 H18 O3 |
Name | vibralactone, bound form; (1R,5S)-5-hydroxy-3-(hydroxymethyl)-1-(3-methylbut-2-en-1-yl)cyclopent-2-ene-1-carbaldehyde |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920993
|
PDB chain | 4lqi Chain Y Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|