Structure of PDB 3dy3 Chain Y Binding Site BS01 |
|
|
Ligand ID | SLR |
InChI | InChI=1S/C10H17NO5/c1-4(2)6(12)10(9(15)16)7(13)5(3)8(14)11-10/h4-7,12-13H,1-3H3,(H,11,14)(H,15,16)/t5-,6+,7-,10-/m1/s1 |
InChIKey | USVJHCXEVSVUEZ-JTGULSINSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C[C@@H]1[C@H]([C@](NC1=O)([C@H](C(C)C)O)C(=O)O)O | CACTVS 3.341 | CC(C)[C@H](O)[C@]1(NC(=O)[C@H](C)[C@H]1O)C(O)=O | ACDLabs 10.04 | O=C1NC(C(=O)O)(C(O)C1C)C(O)C(C)C | OpenEye OEToolkits 1.5.0 | CC1C(C(NC1=O)(C(C(C)C)O)C(=O)O)O | CACTVS 3.341 | CC(C)[CH](O)[C]1(NC(=O)[CH](C)[CH]1O)C(O)=O |
|
Formula | C10 H17 N O5 |
Name | (3R,4R)-3-hydroxy-2-[(1S)-1-hydroxy-2-methylpropyl]-4-methyl-5-oxo-D-proline |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058638563
|
PDB chain | 3dy3 Chain Y Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|