Structure of PDB 5ccs Chain X Binding Site BS01 |
|
|
Ligand ID | C4Y |
InChI | InChI=1S/C20H24N4O2/c21-17-10-8-15(9-11-17)13-22-20(26)23-14-19(25)24-12-4-7-18(24)16-5-2-1-3-6-16/h1-3,5-6,8-11,18H,4,7,12-14,21H2,(H2,22,23,26)/t18-/m1/s1 |
InChIKey | DBVKUBKWQMJAPI-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1ccc(cc1)C2CCCN2C(=O)CNC(=O)NCc3ccc(cc3)N | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)[C@H]2CCCN2C(=O)CNC(=O)NCc3ccc(cc3)N | CACTVS 3.385 | Nc1ccc(CNC(=O)NCC(=O)N2CCC[CH]2c3ccccc3)cc1 | ACDLabs 12.01 | N(Cc1ccc(cc1)N)C(=O)NCC(=O)N2CCCC2c3ccccc3 | CACTVS 3.385 | Nc1ccc(CNC(=O)NCC(=O)N2CCC[C@@H]2c3ccccc3)cc1 |
|
Formula | C20 H24 N4 O2 |
Name | 1-(4-aminobenzyl)-3-{2-oxo-2-[(2R)-2-phenylpyrrolidin-1-yl]ethyl}urea |
ChEMBL | CHEMBL3799575 |
DrugBank | |
ZINC | ZINC000584905531
|
PDB chain | 5ccs Chain X Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.2.1.8: peptidylprolyl isomerase. |
|
|
|