Structure of PDB 4mx5 Chain X Binding Site BS01 |
|
|
Ligand ID | 5MX |
InChI | InChI=1S/C17H17N7O4/c18-16-23-13-12(15(26)24-16)21-8-11(22-13)14(25)19-6-7-20-17(27)28-9-10-4-2-1-3-5-10/h1-5,8H,6-7,9H2,(H,19,25)(H,20,27)(H3,18,22,23,24,26) |
InChIKey | FJTRYGAGSOPOQZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(cc1)COC(=O)NCCNC(=O)c2cnc3c(n2)N=C(NC3=O)N | CACTVS 3.385 | NC1=Nc2nc(cnc2C(=O)N1)C(=O)NCCNC(=O)OCc3ccccc3 | ACDLabs 12.01 | O=C(OCc1ccccc1)NCCNC(=O)c2nc3N=C(N)NC(=O)c3nc2 |
|
Formula | C17 H17 N7 O4 |
Name | benzyl (2-{[(2-amino-4-oxo-3,4-dihydropteridin-7-yl)carbonyl]amino}ethyl)carbamate |
ChEMBL | CHEMBL3098919 |
DrugBank | |
ZINC | ZINC000098208522
|
PDB chain | 4mx5 Chain X Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
V81 |
Catalytic site (residue number reindexed from 1) |
V77 |
Enzyme Commision number |
3.2.2.22: rRNA N-glycosylase. |
|
|
|