Structure of PDB 4j5c Chain X Binding Site BS01 |
|
|
Ligand ID | 7I6 |
InChI | InChI=1S/C24H32N4O2S2/c1-31-15-13-20(27-24(30)26-16-17-9-11-18(25)12-10-17)23(29)28-14-5-7-21(28)19-6-3-4-8-22(19)32-2/h3-4,6,8-12,20-21H,5,7,13-16,25H2,1-2H3,(H2,26,27,30)/t20-,21+/m0/s1 |
InChIKey | SXQHCTVKKRKZEF-LEWJYISDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CSCC[C@@H](C(=O)N1CCC[C@@H]1c2ccccc2SC)NC(=O)NCc3ccc(cc3)N | CACTVS 3.370 | CSCC[CH](NC(=O)NCc1ccc(N)cc1)C(=O)N2CCC[CH]2c3ccccc3SC | ACDLabs 12.01 | O=C(N2C(c1c(SC)cccc1)CCC2)C(NC(=O)NCc3ccc(N)cc3)CCSC | OpenEye OEToolkits 1.7.6 | CSCCC(C(=O)N1CCCC1c2ccccc2SC)NC(=O)NCc3ccc(cc3)N | CACTVS 3.370 | CSCC[C@H](NC(=O)NCc1ccc(N)cc1)C(=O)N2CCC[C@@H]2c3ccccc3SC |
|
Formula | C24 H32 N4 O2 S2 |
Name | 1-(4-aminobenzyl)-3-[(2S)-4-(methylsulfanyl)-1-{(2R)-2-[2-(methylsulfanyl)phenyl]pyrrolidin-1-yl}-1-oxobutan-2-yl]urea |
ChEMBL | CHEMBL3797711 |
DrugBank | |
ZINC | ZINC000098208574
|
PDB chain | 4j5c Chain X Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.2.1.8: peptidylprolyl isomerase. |
|
|
|