Structure of PDB 3pb7 Chain X Binding Site BS01 |
|
|
Ligand ID | PBD |
InChI | InChI=1S/C15H20N4O2S/c1-20-13-5-4-12(10-14(13)21-2)18-15(22)17-6-3-8-19-9-7-16-11-19/h4-5,7,9-11H,3,6,8H2,1-2H3,(H2,17,18,22) |
InChIKey | FZQXMGLQANXZRP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1ccc(NC(=S)NCCCn2ccnc2)cc1OC | ACDLabs 12.01 | S=C(NCCCn1ccnc1)Nc2ccc(OC)c(OC)c2 | OpenEye OEToolkits 1.7.0 | COc1ccc(cc1OC)NC(=S)NCCCn2ccnc2 |
|
Formula | C15 H20 N4 O2 S |
Name | 1-(3,4-dimethoxyphenyl)-3-[3-(1H-imidazol-1-yl)propyl]thiourea |
ChEMBL | CHEMBL201747 |
DrugBank | |
ZINC | ZINC000013679617
|
PDB chain | 3pb7 Chain X Residue 390
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.3.2.5: glutaminyl-peptide cyclotransferase. |
|
|
|