Structure of PDB 3nzb Chain X Binding Site BS01 |
|
|
Ligand ID | D2N |
InChI | InChI=1S/C24H31N5O4/c1-4-32-20(30)8-6-5-7-11-33-18-9-10-19(31-3)16(13-18)12-17-14-27-23-21(15(17)2)22(25)28-24(26)29-23/h9-10,13-14H,4-8,11-12H2,1-3H3,(H4,25,26,27,28,29) |
InChIKey | FGBRLIYQKRWOSO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCOC(=O)CCCCCOc1ccc(OC)c(Cc2cnc3nc(N)nc(N)c3c2C)c1 | ACDLabs 12.01 | O=C(OCC)CCCCCOc1cc(c(OC)cc1)Cc2c(c3c(nc2)nc(nc3N)N)C | OpenEye OEToolkits 1.7.0 | CCOC(=O)CCCCCOc1ccc(c(c1)Cc2cnc3c(c2C)c(nc(n3)N)N)OC |
|
Formula | C24 H31 N5 O4 |
Name | ethyl 6-{3-[(2,4-diamino-5-methylpyrido[2,3-d]pyrimidin-6-yl)methyl]-4-methoxyphenoxy}hexanoate |
ChEMBL | CHEMBL435938 |
DrugBank | |
ZINC | ZINC000013646399
|
PDB chain | 3nzb Chain X Residue 207
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|