Structure of PDB 3kwb Chain X Binding Site BS01 |
|
|
Ligand ID | ORH |
InChI | InChI=1S/C19H20F3N5O2/c20-19(21,22)14-6-4-7-15(12-14)27-18(29)26(17(28)16(13-23)24-27)11-5-10-25-8-2-1-3-9-25/h4,6-7,12H,1-3,5,8-11H2 |
InChIKey | HKAVWQNLXOMWLR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | FC(F)(F)c1cccc(c1)N2N=C(C#N)C(=O)N(CCCN3CCCCC3)C2=O | OpenEye OEToolkits 1.7.0 | c1cc(cc(c1)N2C(=O)N(C(=O)C(=N2)C#N)CCCN3CCCCC3)C(F)(F)F |
|
Formula | C19 H20 F3 N5 O2 |
Name | 3,5-dioxo-4-(3-piperidin-1-ylpropyl)-2-[3-(trifluoromethyl)phenyl]-2,3,4,5-tetrahydro-1,2,4-triazine-6-carbonitrile |
ChEMBL | CHEMBL1084114 |
DrugBank | |
ZINC | ZINC000049046145
|
PDB chain | 3kwb Chain X Residue 1216
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.22.38: cathepsin K. |
|
|
|