Structure of PDB 3fyk Chain X Binding Site BS01 |
|
|
Ligand ID | B98 |
InChI | InChI=1S/C13H15N3O2S/c1-18-8-2-3-10-9(4-8)11-12(19-10)13(17)16-7(5-14)6-15-11/h2-4,7,15H,5-6,14H2,1H3,(H,16,17)/t7-/m1/s1 |
InChIKey | TXYKBKYDFZQOCB-SSDOTTSWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | COc1ccc2c(c1)c3c(s2)C(=O)N[C@@H](CN3)CN | ACDLabs 10.04 | O=C2NC(CNc1c3cc(OC)ccc3sc12)CN | OpenEye OEToolkits 1.5.0 | COc1ccc2c(c1)c3c(s2)C(=O)NC(CN3)CN | CACTVS 3.341 | COc1ccc2sc3C(=O)N[CH](CN)CNc3c2c1 | CACTVS 3.341 | COc1ccc2sc3C(=O)N[C@H](CN)CNc3c2c1 |
|
Formula | C13 H15 N3 O2 S |
Name | (3R)-3-(aminomethyl)-9-methoxy-1,2,3,4-tetrahydro-5H-[1]benzothieno[3,2-e][1,4]diazepin-5-one |
ChEMBL | CHEMBL555205 |
DrugBank | DB07431 |
ZINC | ZINC000039258537
|
PDB chain | 3fyk Chain X Residue 372
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
N191 D207 |
Catalytic site (residue number reindexed from 1) |
N147 D163 |
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. |
|
|
|