Structure of PDB 6ag7 Chain U Binding Site BS01 |
|
|
Ligand ID | H55 |
InChI | InChI=1S/C10H13N9O/c1-19-3-4(2-15-19)5-7(11)17-8(12)6(16-5)9(20)18-10(13)14/h2-3H,1H3,(H4,11,12,17)(H4,13,14,18,20) |
InChIKey | MHKIPNGQRFWGIB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(N/C(N)=N)c1c(N)nc(N)c(n1)c2cn(nc2)C | CACTVS 3.385 | Cn1cc(cn1)c2nc(c(N)nc2N)C(=O)NC(N)=N | OpenEye OEToolkits 2.0.6 | Cn1cc(cn1)c2c(nc(c(n2)C(=O)NC(=N)N)N)N | OpenEye OEToolkits 2.0.6 | [H]/N=C(/N)\NC(=O)c1c(nc(c(n1)c2cnn(c2)C)N)N |
|
Formula | C10 H13 N9 O |
Name | 3,5-diamino-N-carbamimidoyl-6-(1-methyl-1H-pyrazol-4-yl)pyrazine-2-carboxamide |
ChEMBL | CHEMBL4565975 |
DrugBank | |
ZINC |
|
PDB chain | 6ag7 Chain U Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|