Structure of PDB 6n80 Chain T Binding Site BS01 |
|
|
Ligand ID | JT7 |
InChI | InChI=1S/C19H30BClN2O5/c1-11(2)8-16(19(25)23-17(20(26)27)9-12(3)4)22-18(24)14-7-6-13(28-5)10-15(14)21/h6-7,10-12,16-17,26-27H,8-9H2,1-5H3,(H,22,24)(H,23,25)/t16-,17-/m0/s1 |
InChIKey | IUZAVACFOSUDSF-IRXDYDNUSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1c(C(NC(C(NC(CC(C)C)B(O)O)=O)CC(C)C)=O)ccc(OC)c1 | OpenEye OEToolkits 2.0.6 | B([C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)c1ccc(cc1Cl)OC)(O)O | CACTVS 3.385 | COc1ccc(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)B(O)O)c(Cl)c1 | CACTVS 3.385 | COc1ccc(C(=O)N[CH](CC(C)C)C(=O)N[CH](CC(C)C)B(O)O)c(Cl)c1 | OpenEye OEToolkits 2.0.6 | B(C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)c1ccc(cc1Cl)OC)(O)O |
|
Formula | C19 H30 B Cl N2 O5 |
Name | N-[(1R)-1-borono-3-methylbutyl]-N~2~-(2-chloro-4-methoxybenzene-1-carbonyl)-L-leucinamide |
ChEMBL | CHEMBL4566080 |
DrugBank | |
ZINC |
|
PDB chain | 6n80 Chain T Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|