Structure of PDB 3f5p Chain T Binding Site BS01 |
|
|
Ligand ID | 741 |
InChI | InChI=1S/C27H29ClN6O3S/c1-33(10-11-35)8-4-12-37-24-15-22-20(14-23(24)36-3)26(18(16-29)17-31-22)32-19-5-6-25(21(28)13-19)38-27-30-7-9-34(27)2/h5-7,9,13-15,17,35H,4,8,10-12H2,1-3H3,(H,31,32) |
InChIKey | QEMHSTOIAUCOQF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | Cn1ccnc1Sc2ccc(cc2Cl)Nc3c4cc(c(cc4ncc3C#N)OCCC[N@@](C)CCO)OC | ACDLabs 10.04 | N#Cc2cnc1c(cc(OC)c(OCCCN(CCO)C)c1)c2Nc4cc(Cl)c(Sc3nccn3C)cc4 | OpenEye OEToolkits 1.5.0 | Cn1ccnc1Sc2ccc(cc2Cl)Nc3c4cc(c(cc4ncc3C#N)OCCCN(C)CCO)OC | CACTVS 3.341 | COc1cc2c(Nc3ccc(Sc4nccn4C)c(Cl)c3)c(cnc2cc1OCCCN(C)CCO)C#N |
|
Formula | C27 H29 Cl N6 O3 S |
Name | 4-[[3-chloro-4-(1-methylimidazol-2-yl)sulfanyl-phenyl]amino]-7-[3-(2-hydroxyethyl-methyl-amino)propoxy]-6-methoxy-quinoline-3-carbonitrile |
ChEMBL | CHEMBL460164 |
DrugBank | |
ZINC | ZINC000039715813
|
PDB chain | 3f5p Chain T Residue 16
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
N1140 D1153 |
Catalytic site (residue number reindexed from 1) |
N152 D165 |
Enzyme Commision number |
2.7.10.1: receptor protein-tyrosine kinase. |
|
|
|