Structure of PDB 8w8a Chain R Binding Site BS01 |
|
|
Ligand ID | T5U |
InChI | InChI=1S/C13H18N2O/c1-2-10(11-6-4-3-5-7-11)8-12-9-16-13(14)15-12/h3-7,10,12H,2,8-9H2,1H3,(H2,14,15)/t10-,12-/m0/s1 |
InChIKey | IXDKFUBXESWHSL-JQWIXIFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC[C@@H](C[C@H]1COC(=N)N1)c2ccccc2 | OpenEye OEToolkits 2.0.7 | [H]/N=C\1/N[C@H](CO1)C[C@H](CC)c2ccccc2 | OpenEye OEToolkits 2.0.7 | CCC(CC1COC(=N)N1)c2ccccc2 | CACTVS 3.385 | CC[CH](C[CH]1COC(=N)N1)c2ccccc2 |
|
Formula | C13 H18 N2 O |
Name | (4S)-4-[(2S)-2-phenylbutyl]-1,3-oxazolidin-2-imine; RO5256390 |
ChEMBL | CHEMBL3684869 |
DrugBank | |
ZINC | ZINC000113978348
|
PDB chain | 8w8a Chain R Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
Biological Process |
GO:0007186 |
G protein-coupled receptor signaling pathway |
GO:0007189 |
adenylate cyclase-activating G protein-coupled receptor signaling pathway |
GO:0007193 |
adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway |
GO:0007200 |
phospholipase C-activating G protein-coupled receptor signaling pathway |
|
|