Structure of PDB 8t3o Chain R Binding Site BS01 |
|
|
Ligand ID | YN9 |
InChI | InChI=1S/C23H21FO3/c1-16-2-7-18(8-3-16)22-12-9-20(24)14-19(22)15-27-21-10-4-17(5-11-21)6-13-23(25)26/h2-5,7-12,14H,6,13,15H2,1H3,(H,25,26) |
InChIKey | LPGBXHWIQNZEJB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ccc(cc1)c2ccc(F)cc2COc3ccc(CCC(O)=O)cc3 | OpenEye OEToolkits 2.0.7 | Cc1ccc(cc1)c2ccc(cc2COc3ccc(cc3)CCC(=O)O)F | ACDLabs 12.01 | Cc1ccc(cc1)c1ccc(F)cc1COc1ccc(cc1)CCC(=O)O |
|
Formula | C23 H21 F O3 |
Name | 3-{4-[(4-fluoro-4'-methyl[1,1'-biphenyl]-2-yl)methoxy]phenyl}propanoic acid |
ChEMBL | CHEMBL2058533 |
DrugBank | |
ZINC | ZINC000081213892
|
PDB chain | 8t3o Chain R Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|