Structure of PDB 8ikh Chain R Binding Site BS01 |
|
|
Ligand ID | Q2L |
InChI | InChI=1S/C23H20N2O3/c1-28-21-14-8-6-11-17(21)19(15-25(26)27)22-18-12-5-7-13-20(18)24-23(22)16-9-3-2-4-10-16/h2-14,19,24H,15H2,1H3/t19-/m0/s1 |
InChIKey | RHDQEIKBUOYTCY-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccccc1[C@H](C[N+]([O-])=O)c2c([nH]c3ccccc23)c4ccccc4 | OpenEye OEToolkits 2.0.7 | COc1ccccc1[C@H](C[N+](=O)[O-])c2c3ccccc3[nH]c2c4ccccc4 | CACTVS 3.385 | COc1ccccc1[CH](C[N+]([O-])=O)c2c([nH]c3ccccc23)c4ccccc4 | OpenEye OEToolkits 2.0.7 | COc1ccccc1C(C[N+](=O)[O-])c2c3ccccc3[nH]c2c4ccccc4 |
|
Formula | C23 H20 N2 O3 |
Name | 3-[(1R)-1-(2-methoxyphenyl)-2-nitro-ethyl]-2-phenyl-1H-indole |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8ikh Chain R Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|