Structure of PDB 8gur Chain R Binding Site BS01 |
|
|
Ligand ID | 9GF |
InChI | InChI=1S/C24H40O3/c1-4-5-6-7-14-24(2,3)19-11-13-21(23(27)16-19)22-17-20(26)12-10-18(22)9-8-15-25/h11,13,16,18,20,22,25-27H,4-10,12,14-15,17H2,1-3H3/t18-,20-,22-/m1/s1 |
InChIKey | YNZFFALZMRAPHQ-SYYKKAFVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCCCC(C)(C)c1ccc([C@@H]2C[C@H](O)CC[C@H]2CCCO)c(O)c1 | OpenEye OEToolkits 2.0.6 | CCCCCCC(C)(C)c1ccc(c(c1)O)[C@@H]2C[C@@H](CC[C@H]2CCCO)O | CACTVS 3.385 | CCCCCCC(C)(C)c1ccc([CH]2C[CH](O)CC[CH]2CCCO)c(O)c1 | OpenEye OEToolkits 2.0.6 | CCCCCCC(C)(C)c1ccc(c(c1)O)C2CC(CCC2CCCO)O | ACDLabs 12.01 | CCCCCCC(C)(C)c2ccc(C1C(CCC(C1)O)CCCO)c(c2)O |
|
Formula | C24 H40 O3 |
Name | 2-[(1R,2R,5R)-5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-5-(2-methyloctan-2-yl)phenol |
ChEMBL | CHEMBL559612 |
DrugBank | |
ZINC | ZINC000002568244
|
PDB chain | 8gur Chain R Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|