Structure of PDB 8gfw Chain R Binding Site BS01 |
|
|
Ligand ID | G1I |
InChI | InChI=1S/C11H15NO3/c1-12-8-4-2-7-6(10(8)14)3-5-9(13)11(7)15/h3,5,8,10,12-15H,2,4H2,1H3/t8-,10-/m1/s1 |
InChIKey | VJBMHARWYAGTQQ-PSASIEDQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CNC1CCc2c(ccc(c2O)O)C1O | CACTVS 3.385 | CN[C@@H]1CCc2c(O)c(O)ccc2[C@H]1O | CACTVS 3.385 | CN[CH]1CCc2c(O)c(O)ccc2[CH]1O | OpenEye OEToolkits 2.0.7 | CN[C@@H]1CCc2c(ccc(c2O)O)[C@H]1O |
|
Formula | C11 H15 N O3 |
Name | (5R,6R)-6-(methylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8gfw Chain R Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|