Structure of PDB 7yud Chain R Binding Site BS01 |
|
|
Ligand ID | J89 |
InChI | InChI=1S/C19H34NO5P/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)13-14-19(20,15-21)16-25-26(22,23)24/h9-12,21H,2-8,13-16,20H2,1H3,(H2,22,23,24)/t19-/m0/s1 |
InChIKey | LRFKWQGGENFBFO-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCCCCCCCc1ccc(cc1)CC[C@](CO)(COP(=O)(O)O)N | CACTVS 3.385 | CCCCCCCCc1ccc(CC[C](N)(CO)CO[P](O)(O)=O)cc1 | OpenEye OEToolkits 2.0.7 | CCCCCCCCc1ccc(cc1)CCC(CO)(COP(=O)(O)O)N | CACTVS 3.385 | CCCCCCCCc1ccc(CC[C@](N)(CO)CO[P](O)(O)=O)cc1 |
|
Formula | C19 H34 N O5 P |
Name | (2~{S})-2-azanyl-4-(4-octylphenyl)-2-[[oxidanyl-bis(oxidanylidene)-$l^{6}-phosphanyl]oxymethyl]butan-1-ol |
ChEMBL | CHEMBL366208 |
DrugBank | |
ZINC | ZINC000014163159
|
PDB chain | 7yud Chain R Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|