Structure of PDB 7sqo Chain R Binding Site BS01 |
|
|
Ligand ID | A6F |
InChI | InChI=1S/C21H32N2O5S/c1-27-21(24)23-14-6-9-19(22-29(2,25)26)20(23)15-28-18-12-10-17(11-13-18)16-7-4-3-5-8-16/h3-5,7-8,17-20,22H,6,9-15H2,1-2H3/t17-,18+,19-,20-/m0/s1 |
InChIKey | UXZAJSZFFARTEI-YRPNKDGESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COC(=O)N1CCC[CH](N[S](C)(=O)=O)[CH]1CO[CH]2CC[CH](CC2)c3ccccc3 | ACDLabs 12.01 | COC(=O)N1CCCC(NS(C)(=O)=O)C1COC1CCC(CC1)c1ccccc1 | OpenEye OEToolkits 2.0.7 | COC(=O)N1CCC[C@@H]([C@@H]1COC2CCC(CC2)c3ccccc3)NS(=O)(=O)C | OpenEye OEToolkits 2.0.7 | COC(=O)N1CCCC(C1COC2CCC(CC2)c3ccccc3)NS(=O)(=O)C | CACTVS 3.385 | COC(=O)N1CCC[C@H](N[S](C)(=O)=O)[C@@H]1CO[C@@H]2CC[C@@H](CC2)c3ccccc3 |
|
Formula | C21 H32 N2 O5 S |
Name | methyl (2R,3S)-3-[(methanesulfonyl)amino]-2-({[(1s,4S)-4-phenylcyclohexyl]oxy}methyl)piperidine-1-carboxylate |
ChEMBL | CHEMBL4650341 |
DrugBank | DB16962 |
ZINC |
|
PDB chain | 7sqo Chain R Residue 505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|