Structure of PDB 6ow7 Chain Q Binding Site BS01 |
|
|
Ligand ID | N9Y |
InChI | InChI=1S/C20H29N5O4/c26-14-24(29)13-16(12-15-6-1-2-7-15)20(28)25-17(8-5-11-22-25)19(27)23-18-9-3-4-10-21-18/h3-4,9-10,14-17,22,29H,1-2,5-8,11-13H2,(H,21,23,27)/t16-,17+/m1/s1 |
InChIKey | IGYIJLMSSQSKHF-SJORKVTESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | ON(C[CH](CC1CCCC1)C(=O)N2NCCC[CH]2C(=O)Nc3ccccn3)C=O | OpenEye OEToolkits 2.0.7 | c1ccnc(c1)NC(=O)C2CCCNN2C(=O)C(CC3CCCC3)CN(C=O)O | OpenEye OEToolkits 2.0.7 | c1ccnc(c1)NC(=O)[C@@H]2CCCNN2C(=O)[C@H](CC3CCCC3)CN(C=O)O | CACTVS 3.385 | ON(C[C@@H](CC1CCCC1)C(=O)N2NCCC[C@H]2C(=O)Nc3ccccn3)C=O | ACDLabs 12.01 | C(N(C=O)O)C(CC1CCCC1)C(N2C(CCCN2)C(=O)Nc3ccccn3)=O |
|
Formula | C20 H29 N5 O4 |
Name | (3S)-2-{(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl}-N-(pyridin-2-yl)hexahydropyridazine-3-carboxamide |
ChEMBL | CHEMBL4466084 |
DrugBank | |
ZINC |
|
PDB chain | 6ow7 Chain Q Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|