Structure of PDB 3n86 Chain Q Binding Site BS01 |
|
|
Ligand ID | RJP |
InChI | InChI=1S/C16H17NO6/c18-12-9-16(23,15(21)22)8-10(14(12)20)6-7-13(19)17-11-4-2-1-3-5-11/h1-5,8,12,18,23H,6-7,9H2,(H,17,19)(H,21,22)/t12-,16+/m1/s1 |
InChIKey | LCRSMARNUPCDAZ-WBMJQRKESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1ccc(cc1)NC(=O)CCC2=CC(CC(C2=O)O)(C(=O)O)O | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)NC(=O)CCC2=C[C@](C[C@H](C2=O)O)(C(=O)O)O | CACTVS 3.370 | O[C@@H]1C[C@@](O)(C=C(CCC(=O)Nc2ccccc2)C1=O)C(O)=O | ACDLabs 12.01 | O=C(O)C1(O)C=C(C(=O)C(O)C1)CCC(=O)Nc2ccccc2 | CACTVS 3.370 | O[CH]1C[C](O)(C=C(CCC(=O)Nc2ccccc2)C1=O)C(O)=O |
|
Formula | C16 H17 N O6 |
Name | (1R,5R)-1,5-dihydroxy-4-oxo-3-[3-oxo-3-(phenylamino)propyl]cyclohex-2-ene-1-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000066167003
|
PDB chain | 3n86 Chain N Residue 147
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|